C16H15N5O2 — CID 71919997
(3-hydroxyazetidin-1-yl)-(5-methyl-1-quinolin-5-yltriazol-4-yl)methanone (PubChem CID 71919997) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is (3-hydroxyazetidin-1-yl)-(5-methyl-1-quinolin-5-yltriazol-4-yl)methanone.
| Compound Name | (3-hydroxyazetidin-1-yl)-(5-methyl-1-quinolin-5-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 71919997 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (3-hydroxyazetidin-1-yl)-(5-methyl-1-quinolin-5-yltriazol-4-yl)methanone |
| SMILES | Cc1c(C(=O)N2CC(O)C2)nnn1-c1cccc2ncccc12 |
| InChI | InChI=1S/C16H15N5O2/c1-10-15(16(23)20-8-11(22)9-20)18-19-21(10)14-6-2-5-13-12(14)4-3-7-17-13/h2-7,11,22H,8-9H2,1H3 |
| InChIKey | NWWWPQGGIQJVGS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |