C19H20N6O2 — CID 95175654
(2R)-N-methyl-1-(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 95175654) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (2R)-N-methyl-1-(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-methyl-1-(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95175654 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2R)-N-methyl-1-(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CCCN1C(=O)c1nnn(-c2cccc3ncccc23)c1C |
| InChI | InChI=1S/C19H20N6O2/c1-12-17(19(27)24-11-5-9-16(24)18(26)20-2)22-23-25(12)15-8-3-7-14-13(15)6-4-10-21-14/h3-4,6-8,10,16H,5,9,11H2,1-2H3,(H,20,26)/t16-/m1/s1 |
| InChIKey | TZOJRLQRSDMGGE-MRXNPFEDSA-N |
| XLogP | 1.47 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |