C18H21N5O5 — CID 120539086
1-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]cycloheptane-1-carboxylic acid (PubChem CID 120539086) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539086 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]cycloheptane-1-carboxylic acid |
| SMILES | Cc1c(C(=O)NC2(C(=O)O)CCCCCC2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21N5O5/c1-12-15(16(24)19-18(17(25)26)9-4-2-3-5-10-18)20-21-22(12)13-7-6-8-14(11-13)23(27)28/h6-8,11H,2-5,9-10H2,1H3,(H,19,24)(H,25,26) |
| InChIKey | GCEBUHHNVQFGOX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|