C11H12N4O6 — CID 176895750
2-pyridin-2-yl-1,3,5-triazinane-1,3,5-tricarboxylic acid (PubChem CID 176895750) has the molecular formula C11H12N4O6 and a molecular weight of 296.24 g/mol. Its IUPAC name is 2-pyridin-2-yl-1,3,5-triazinane-1,3,5-tricarboxylic acid.
| Compound Name | 2-pyridin-2-yl-1,3,5-triazinane-1,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 176895750 |
| Molecular Formula | C11H12N4O6 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-pyridin-2-yl-1,3,5-triazinane-1,3,5-tricarboxylic acid |
| SMILES | O=C(O)N1CN(C(=O)O)C(c2ccccn2)N(C(=O)O)C1 |
| InChI | InChI=1S/C11H12N4O6/c16-9(17)13-5-14(10(18)19)8(15(6-13)11(20)21)7-3-1-2-4-12-7/h1-4,8H,5-6H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | AHWKYYALBIVPES-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |