C14H15FNO3S- — CID 6945941
(2S,4R)-3-butanoyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 6945941) has the molecular formula C14H15FNO3S- and a molecular weight of 296.34 g/mol. Its IUPAC name is (2S,4R)-3-butanoyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | (2S,4R)-3-butanoyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 6945941 |
| Molecular Formula | C14H15FNO3S- |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2S,4R)-3-butanoyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCC(=O)N1[C@H](C(=O)[O-])CS[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C14H16FNO3S/c1-2-4-12(17)16-11(14(18)19)8-20-13(16)9-5-3-6-10(15)7-9/h3,5-7,11,13H,2,4,8H2,1H3,(H,18,19)/p-1/t11-,13-/m0/s1 |
| InChIKey | PWIRIPDXSQGADM-AAEUAGOBSA-M |
| XLogP | 1.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |