C14H17NO3 — CID 67205661
ethyl (3S,5S)-5-(3-methylphenyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 67205661) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl (3S,5S)-5-(3-methylphenyl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,5S)-5-(3-methylphenyl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 67205661 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl (3S,5S)-5-(3-methylphenyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](c2cccc(C)c2)NC1=O |
| InChI | InChI=1S/C14H17NO3/c1-3-18-14(17)11-8-12(15-13(11)16)10-6-4-5-9(2)7-10/h4-7,11-12H,3,8H2,1-2H3,(H,15,16)/t11-,12-/m0/s1 |
| InChIKey | SJJMDDVWMPQLJM-RYUDHWBXSA-N |
| XLogP | 1.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|