C20H25NO6 — CID 73374269
ethyl 7-(2,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,4a,6,7,8,8a-octahydroquinoline-3-carboxylate (PubChem CID 73374269) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl 7-(2,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,4a,6,7,8,8a-octahydroquinoline-3-carboxylate.
| Compound Name | ethyl 7-(2,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,4a,6,7,8,8a-octahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 73374269 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | ethyl 7-(2,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,4a,6,7,8,8a-octahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1CC2C(=O)CC(c3ccc(OC)cc3OC)CC2NC1=O |
| InChI | InChI=1S/C20H25NO6/c1-4-27-20(24)15-10-14-16(21-19(15)23)7-11(8-17(14)22)13-6-5-12(25-2)9-18(13)26-3/h5-6,9,11,14-16H,4,7-8,10H2,1-3H3,(H,21,23) |
| InChIKey | XDOKXWXHQOAQTF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|