C14H17NO3 — CID 142193926
ethyl 8-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-3-carboxylate (PubChem CID 142193926) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 8-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-3-carboxylate.
| Compound Name | ethyl 8-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 142193926 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 8-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-3-carboxylate |
| SMILES | CCOC(=O)C1CCc2ccc(C)cc2NC1=O |
| InChI | InChI=1S/C14H17NO3/c1-3-18-14(17)11-7-6-10-5-4-9(2)8-12(10)15-13(11)16/h4-5,8,11H,3,6-7H2,1-2H3,(H,15,16) |
| InChIKey | YOVXHBOKVVKKFE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|