About ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate
ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate (PubChem CID 163529307) has the molecular formula C16H23NO2
and a molecular weight of 261.36 g/mol. Its IUPAC name is ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate |
| PubChem CID | 163529307 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate |
| SMILES | CCOC(=O)C1CCc2cc(N(CC)CC)ccc21 |
| InChI | InChI=1S/C16H23NO2/c1-4-17(5-2)13-8-10-14-12(11-13)7-9-15(14)16(18)19-6-3/h8,10-11,15H,4-7,9H2,1-3H3 |
| InChIKey | DRNYJNJWUGCRQM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate?
The IUPAC name of ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate (CID 163529307) is ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate.
What is the SMILES notation for ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate?
The canonical SMILES for ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate is CCOC(=O)C1CCc2cc(N(CC)CC)ccc21.
What is the InChIKey of ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate?
The InChIKey is DRNYJNJWUGCRQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-4-17(5-2)13-8-10-14-12(11-13)7-9-15(14)16(18)19-6-3/h8,10-11,15H,4-7,9H2,1-3H3.
What are the key properties of ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate?
ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate has a molecular weight of 261.36 g/mol, XLogP of 3.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(diethylamino)-2,3-dihydro-1H-indene-1-carboxylate is sourced from PubChem (CID 163529307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).