C25H29NO4 — CID 162647745
(9E)-7-[4-[3-(dimethylamino)phenyl]phenyl]-1,5-dioxacyclotridec-9-ene-6,13-dione (PubChem CID 162647745) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (9E)-7-[4-[3-(dimethylamino)phenyl]phenyl]-1,5-dioxacyclotridec-9-ene-6,13-dione.
| Compound Name | (9E)-7-[4-[3-(dimethylamino)phenyl]phenyl]-1,5-dioxacyclotridec-9-ene-6,13-dione |
|---|---|
| PubChem CID | 162647745 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (9E)-7-[4-[3-(dimethylamino)phenyl]phenyl]-1,5-dioxacyclotridec-9-ene-6,13-dione |
| SMILES | CN(C)c1cccc(-c2ccc(C3C/C=C/CCC(=O)OCCCOC3=O)cc2)c1 |
| InChI | InChI=1S/C25H29NO4/c1-26(2)22-9-6-8-21(18-22)19-12-14-20(15-13-19)23-10-4-3-5-11-24(27)29-16-7-17-30-25(23)28/h3-4,6,8-9,12-15,18,23H,5,7,10-11,16-17H2,1-2H3/b4-3+ |
| InChIKey | SVQSXLMLVNHHAO-ONEGZZNKSA-N |
| XLogP | 4.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|