About ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate
ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate (PubChem CID 99866901) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate.
Analyze ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate?
The IUPAC name of ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate (CID 99866901) is ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate.
What is the SMILES notation for ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate?
The canonical SMILES for ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate is CCOC(=O)[C@H]1CNc2ccc(C)cc2C1.
What is the InChIKey of ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate?
The InChIKey is DBMVQUYPRJIPLJ-LLVKDONJSA-N. The full InChI is InChI=1S/C13H17NO2/c1-3-16-13(15)11-7-10-6-9(2)4-5-12(10)14-8-11/h4-6,11,14H,3,7-8H2,1-2H3/t11-/m1/s1.
What are the key properties of ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate?
ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate has a molecular weight of 219.28 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-6-methyl-1,2,3,4-tetrahydroquinoline-3-carboxylate is sourced from PubChem (CID 99866901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).