C14H21NO2 — CID 91170420
ethane;ethyl 1,2,3,4-tetrahydroquinoline-3-carboxylate (PubChem CID 91170420) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is ethane;ethyl 1,2,3,4-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethane;ethyl 1,2,3,4-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 91170420 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | ethane;ethyl 1,2,3,4-tetrahydroquinoline-3-carboxylate |
| SMILES | CC.CCOC(=O)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C12H15NO2.C2H6/c1-2-15-12(14)10-7-9-5-3-4-6-11(9)13-8-10;1-2/h3-6,10,13H,2,7-8H2,1H3;1-2H3 |
| InChIKey | PPNODIZPOYAMFI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |