C21H21ClFNO2 — CID 118348712
ethyl 7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinoline-3-carboxylate (PubChem CID 118348712) has the molecular formula C21H21ClFNO2 and a molecular weight of 373.86 g/mol. Its IUPAC name is ethyl 7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118348712 |
| Molecular Formula | C21H21ClFNO2 |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | ethyl 7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1CNc2cc(/C=C(\C)c3c(F)cccc3Cl)ccc2C1 |
| InChI | InChI=1S/C21H21ClFNO2/c1-3-26-21(25)16-11-15-8-7-14(10-19(15)24-12-16)9-13(2)20-17(22)5-4-6-18(20)23/h4-10,16,24H,3,11-12H2,1-2H3/b13-9+ |
| InChIKey | BGGFGZLEADFGDI-UKTHLTGXSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|