C24H28Cl2FN3O4S — CID 129306929
1-[1-amino-1-chloro-3-(ethylamino)propan-2-yl]sulfonyl-7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-quinoline-3-carboxylic acid (PubChem CID 129306929) has the molecular formula C24H28Cl2FN3O4S and a molecular weight of 544.48 g/mol. Its IUPAC name is 1-[1-amino-1-chloro-3-(ethylamino)propan-2-yl]sulfonyl-7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-quinoline-3-carboxylic acid.
| Compound Name | 1-[1-amino-1-chloro-3-(ethylamino)propan-2-yl]sulfonyl-7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 129306929 |
| Molecular Formula | C24H28Cl2FN3O4S |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 1-[1-amino-1-chloro-3-(ethylamino)propan-2-yl]sulfonyl-7-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-quinoline-3-carboxylic acid |
| SMILES | CCNCC(C(N)Cl)S(=O)(=O)N1CC(C(=O)O)Cc2ccc(/C=C(\C)c3c(F)cccc3Cl)cc21 |
| InChI | InChI=1S/C24H28Cl2FN3O4S/c1-3-29-12-21(23(26)28)35(33,34)30-13-17(24(31)32)11-16-8-7-15(10-20(16)30)9-14(2)22-18(25)5-4-6-19(22)27/h4-10,17,21,23,29H,3,11-13,28H2,1-2H3,(H,31,32)/b14-9+ |
| InChIKey | KRPGDSQMYLSFHT-NTEUORMPSA-N |
| XLogP | 3.93 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|