C25H19ClF4N4O2S — CID 129278603
3-azido-7-[2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 129278603) has the molecular formula C25H19ClF4N4O2S and a molecular weight of 550.97 g/mol. Its IUPAC name is 3-azido-7-[2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 3-azido-7-[2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 129278603 |
| Molecular Formula | C25H19ClF4N4O2S |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 3-azido-7-[2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CC(=Cc1ccc2c(c1)N(S(=O)(=O)c1cccc(C(F)(F)F)c1)CC(N=[N+]=[N-])C2)c1c(F)cccc1Cl |
| InChI | InChI=1S/C25H19ClF4N4O2S/c1-15(24-21(26)6-3-7-22(24)27)10-16-8-9-17-12-19(32-33-31)14-34(23(17)11-16)37(35,36)20-5-2-4-18(13-20)25(28,29)30/h2-11,13,19H,12,14H2,1H3 |
| InChIKey | RQONDYZTZKZWNM-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|