C28H25ClF4N4O2S2 — CID 155021302
(4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-[3-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-carbothioamide (PubChem CID 155021302) has the molecular formula C28H25ClF4N4O2S2 and a molecular weight of 625.11 g/mol. Its IUPAC name is (4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-[3-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-carbothioamide.
| Compound Name | (4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-[3-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-carbothioamide |
|---|---|
| PubChem CID | 155021302 |
| Molecular Formula | C28H25ClF4N4O2S2 |
| Molecular Weight | 625.11 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | (4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-[3-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-carbothioamide |
| SMILES | C/C(=C\c1ccc2c(c1)N(S(=O)(=O)c1cccc(C(F)(F)F)c1)C[C@@H]1CN(C(N)=S)CCN21)c1c(F)cccc1Cl |
| InChI | InChI=1S/C28H25ClF4N4O2S2/c1-17(26-22(29)6-3-7-23(26)30)12-18-8-9-24-25(13-18)37(16-20-15-35(27(34)40)10-11-36(20)24)41(38,39)21-5-2-4-19(14-21)28(31,32)33/h2-9,12-14,20H,10-11,15-16H2,1H3,(H2,34,40)/b17-12+/t20-/m0/s1 |
| InChIKey | NVCZPSYDFXTDDA-KZFLWGQDSA-N |
| XLogP | 6.00 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.11 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|