C31H35ClFN3O4S — CID 163634172
2-[(4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-3-yl]-2-methylpropane-1,3-diol (PubChem CID 163634172) has the molecular formula C31H35ClFN3O4S and a molecular weight of 600.16 g/mol. Its IUPAC name is 2-[(4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-3-yl]-2-methylpropane-1,3-diol.
| Compound Name | 2-[(4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-3-yl]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 163634172 |
| Molecular Formula | C31H35ClFN3O4S |
| Molecular Weight | 600.16 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[(4aS)-8-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-3-yl]-2-methylpropane-1,3-diol |
| SMILES | C/C(=C\c1ccc2c(c1)N(S(=O)(=O)c1cccc(C)c1)C[C@@H]1CN(C(C)(CO)CO)CCN21)c1c(F)cccc1Cl |
| InChI | InChI=1S/C31H35ClFN3O4S/c1-21-6-4-7-25(14-21)41(39,40)36-18-24-17-34(31(3,19-37)20-38)12-13-35(24)28-11-10-23(16-29(28)36)15-22(2)30-26(32)8-5-9-27(30)33/h4-11,14-16,24,37-38H,12-13,17-20H2,1-3H3/b22-15+/t24-/m0/s1 |
| InChIKey | WUFQOTYRIILEGL-NLZIUFDSSA-N |
| XLogP | 4.79 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.16 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|