C27H26ClF3N4O4S2 — CID 163783630
(4aR)-8-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-sulfonamide (PubChem CID 163783630) has the molecular formula C27H26ClF3N4O4S2 and a molecular weight of 627.11 g/mol. Its IUPAC name is (4aR)-8-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-sulfonamide.
| Compound Name | (4aR)-8-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-sulfonamide |
|---|---|
| PubChem CID | 163783630 |
| Molecular Formula | C27H26ClF3N4O4S2 |
| Molecular Weight | 627.11 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | (4aR)-8-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-6-(3-methylphenyl)sulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a]quinoxaline-3-sulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N2C[C@@H]3CN(S(N)(=O)=O)CCN3c3ccc(/C=C/c4c(Cl)cccc4C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C27H26ClF3N4O4S2/c1-18-4-2-5-21(14-18)40(36,37)35-17-20-16-33(41(32,38)39)12-13-34(20)25-11-9-19(15-26(25)35)8-10-22-23(27(29,30)31)6-3-7-24(22)28/h2-11,14-15,20H,12-13,16-17H2,1H3,(H2,32,38,39)/b10-8+/t20-/m0/s1 |
| InChIKey | MQSISNVKNQKYQB-MFUYTVRRSA-N |
| XLogP | 4.74 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.11 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|