C34H28ClFN2O5S — CID 129293247
2-[(1R)-1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 129293247) has the molecular formula C34H28ClFN2O5S and a molecular weight of 631.13 g/mol. Its IUPAC name is 2-[(1R)-1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129293247 |
| Molecular Formula | C34H28ClFN2O5S |
| Molecular Weight | 631.13 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | 2-[(1R)-1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | C/C(=C\c1ccc2c(c1)N(S(=O)(=O)c1cccc(C)c1)CC([C@@H](C)N1C(=O)c3ccccc3C1=O)O2)c1c(F)cccc1Cl |
| InChI | InChI=1S/C34H28ClFN2O5S/c1-20-8-6-9-24(16-20)44(41,42)37-19-31(22(3)38-33(39)25-10-4-5-11-26(25)34(38)40)43-30-15-14-23(18-29(30)37)17-21(2)32-27(35)12-7-13-28(32)36/h4-18,22,31H,19H2,1-3H3/b21-17+/t22-,31?/m1/s1 |
| InChIKey | UCRZPVJADHVDFD-PDGDKKLTSA-N |
| XLogP | 6.99 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.13 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|