C21H21ClFNO — CID 144958523
1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinolin-3-yl]propan-2-one (PubChem CID 144958523) has the molecular formula C21H21ClFNO and a molecular weight of 357.86 g/mol. Its IUPAC name is 1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinolin-3-yl]propan-2-one.
| Compound Name | 1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinolin-3-yl]propan-2-one |
|---|---|
| PubChem CID | 144958523 |
| Molecular Formula | C21H21ClFNO |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-1,2,3,4-tetrahydroquinolin-3-yl]propan-2-one |
| SMILES | CC(=O)CC1CNc2ccc(/C=C(\C)c3c(F)cccc3Cl)cc2C1 |
| InChI | InChI=1S/C21H21ClFNO/c1-13(21-18(22)4-3-5-19(21)23)8-15-6-7-20-17(10-15)11-16(12-24-20)9-14(2)25/h3-8,10,16,24H,9,11-12H2,1-2H3/b13-8+ |
| InChIKey | QHYJCECXIAQCIJ-MDWZMJQESA-N |
| XLogP | 5.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|