C20H20ClFO2 — CID 161034028
(1S)-1-[(2S)-6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]ethanol (PubChem CID 161034028) has the molecular formula C20H20ClFO2 and a molecular weight of 346.83 g/mol. Its IUPAC name is (1S)-1-[(2S)-6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]ethanol.
| Compound Name | (1S)-1-[(2S)-6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]ethanol |
|---|---|
| PubChem CID | 161034028 |
| Molecular Formula | C20H20ClFO2 |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (1S)-1-[(2S)-6-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]ethanol |
| SMILES | C/C(=C\c1ccc2c(c1)CC[C@@H]([C@H](C)O)O2)c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H20ClFO2/c1-12(20-16(21)4-3-5-17(20)22)10-14-6-8-19-15(11-14)7-9-18(24-19)13(2)23/h3-6,8,10-11,13,18,23H,7,9H2,1-2H3/b12-10+/t13-,18-/m0/s1 |
| InChIKey | UAAAAXOCCQGMCX-HHSLDDNTSA-N |
| XLogP | 5.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|