C19H21ClFNO2 — CID 144958484
4-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-2-(3-hydroxybutylamino)phenol (PubChem CID 144958484) has the molecular formula C19H21ClFNO2 and a molecular weight of 349.83 g/mol. Its IUPAC name is 4-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-2-(3-hydroxybutylamino)phenol.
| Compound Name | 4-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-2-(3-hydroxybutylamino)phenol |
|---|---|
| PubChem CID | 144958484 |
| Molecular Formula | C19H21ClFNO2 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[(E)-2-(2-chloro-6-fluorophenyl)prop-1-enyl]-2-(3-hydroxybutylamino)phenol |
| SMILES | C/C(=C\c1ccc(O)c(NCCC(C)O)c1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C19H21ClFNO2/c1-12(19-15(20)4-3-5-16(19)21)10-14-6-7-18(24)17(11-14)22-9-8-13(2)23/h3-7,10-11,13,22-24H,8-9H2,1-2H3/b12-10+ |
| InChIKey | PGAOSCNNSAUUQT-ZRDIBKRKSA-N |
| XLogP | 4.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|