C18H16Cl2N2O3 — CID 160998137
3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxamide (PubChem CID 160998137) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxamide.
| Compound Name | 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxamide |
|---|---|
| PubChem CID | 160998137 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxamide |
| SMILES | O=C(CC1CNc2ccc(C(=O)NO)cc2C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c19-14-3-1-11(8-15(14)20)17(23)6-10-5-13-7-12(18(24)22-25)2-4-16(13)21-9-10/h1-4,7-8,10,21,25H,5-6,9H2,(H,22,24) |
| InChIKey | TVNBJIHPHRGYMK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|