C11H14ClNO2 — CID 172907953
ethyl (3S)-2,3-dihydro-1H-indole-3-carboxylate;hydrochloride (PubChem CID 172907953) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is ethyl (3S)-2,3-dihydro-1H-indole-3-carboxylate;hydrochloride.
| Compound Name | ethyl (3S)-2,3-dihydro-1H-indole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 172907953 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | ethyl (3S)-2,3-dihydro-1H-indole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@@H]1CNc2ccccc21.Cl |
| InChI | InChI=1S/C11H13NO2.ClH/c1-2-14-11(13)9-7-12-10-6-4-3-5-8(9)10;/h3-6,9,12H,2,7H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | UTVZZTHZNFVPSH-SBSPUUFOSA-N |
| XLogP | 2.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |