C13H16N2O3 — CID 80565260
methyl (2S)-2-(2,3-dihydro-1H-indole-3-carbonylamino)propanoate (PubChem CID 80565260) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl (2S)-2-(2,3-dihydro-1H-indole-3-carbonylamino)propanoate.
| Compound Name | methyl (2S)-2-(2,3-dihydro-1H-indole-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 80565260 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl (2S)-2-(2,3-dihydro-1H-indole-3-carbonylamino)propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C1CNc2ccccc21 |
| InChI | InChI=1S/C13H16N2O3/c1-8(13(17)18-2)15-12(16)10-7-14-11-6-4-3-5-9(10)11/h3-6,8,10,14H,7H2,1-2H3,(H,15,16)/t8-,10?/m0/s1 |
| InChIKey | HHVPNKHUSJVHBO-PEHGTWAWSA-N |
| XLogP | 0.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |