C17H17ClN2O — CID 81355683
N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 81355683) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 81355683 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CNc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O/c1-11(12-6-8-13(18)9-7-12)20-17(21)15-10-19-16-5-3-2-4-14(15)16/h2-9,11,15,19H,10H2,1H3,(H,20,21)/t11-,15?/m1/s1 |
| InChIKey | VJMSXERBJIBYKH-ZRKZCGFPSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |