C13H14N2O — CID 114417212
N-but-3-yn-2-yl-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 114417212) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-but-3-yn-2-yl-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 114417212 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-but-3-yn-2-yl-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | C#CC(C)NC(=O)C1CNc2ccccc21 |
| InChI | InChI=1S/C13H14N2O/c1-3-9(2)15-13(16)11-8-14-12-7-5-4-6-10(11)12/h1,4-7,9,11,14H,8H2,2H3,(H,15,16) |
| InChIKey | RDCKGMVVVISYDJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|