C13H17NO3 — CID 80565901
3-methoxypropyl 2,3-dihydro-1H-indole-3-carboxylate (PubChem CID 80565901) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-methoxypropyl 2,3-dihydro-1H-indole-3-carboxylate.
| Compound Name | 3-methoxypropyl 2,3-dihydro-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 80565901 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-methoxypropyl 2,3-dihydro-1H-indole-3-carboxylate |
| SMILES | COCCCOC(=O)C1CNc2ccccc21 |
| InChI | InChI=1S/C13H17NO3/c1-16-7-4-8-17-13(15)11-9-14-12-6-3-2-5-10(11)12/h2-3,5-6,11,14H,4,7-9H2,1H3 |
| InChIKey | YSSLVNHTHCLRBU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|