C8H10O4 — CID 130026867
ethyl 2,3-dioxocyclopentane-1-carboxylate (PubChem CID 130026867) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is ethyl 2,3-dioxocyclopentane-1-carboxylate.
| Compound Name | ethyl 2,3-dioxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 130026867 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | ethyl 2,3-dioxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(=O)C1=O |
| InChI | InChI=1S/C8H10O4/c1-2-12-8(11)5-3-4-6(9)7(5)10/h5H,2-4H2,1H3 |
| InChIKey | XHNSLLXZXNKBIU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|