C12H13NO3 — CID 23157134
ethyl 5-oxo-7,8-dihydro-6H-isoquinoline-6-carboxylate (PubChem CID 23157134) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is ethyl 5-oxo-7,8-dihydro-6H-isoquinoline-6-carboxylate.
| Compound Name | ethyl 5-oxo-7,8-dihydro-6H-isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 23157134 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | ethyl 5-oxo-7,8-dihydro-6H-isoquinoline-6-carboxylate |
| SMILES | CCOC(=O)C1CCc2cnccc2C1=O |
| InChI | InChI=1S/C12H13NO3/c1-2-16-12(15)10-4-3-8-7-13-6-5-9(8)11(10)14/h5-7,10H,2-4H2,1H3 |
| InChIKey | PIQBHNYWUXHIGA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|