C15H15NO3 — CID 139081220
ethyl (3R)-4-oxo-1,2,3,9-tetrahydrocarbazole-3-carboxylate (PubChem CID 139081220) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl (3R)-4-oxo-1,2,3,9-tetrahydrocarbazole-3-carboxylate.
| Compound Name | ethyl (3R)-4-oxo-1,2,3,9-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 139081220 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | ethyl (3R)-4-oxo-1,2,3,9-tetrahydrocarbazole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCc2[nH]c3ccccc3c2C1=O |
| InChI | InChI=1S/C15H15NO3/c1-2-19-15(18)10-7-8-12-13(14(10)17)9-5-3-4-6-11(9)16-12/h3-6,10,16H,2,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | VTIVCTQCNXXZBG-SNVBAGLBSA-N |
| XLogP | 2.48 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|