C17H19NO2 — CID 134194719
ethyl (1S,12S,15R)-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15-carboxylate (PubChem CID 134194719) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl (1S,12S,15R)-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15-carboxylate.
| Compound Name | ethyl (1S,12S,15R)-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15-carboxylate |
|---|---|
| PubChem CID | 134194719 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl (1S,12S,15R)-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CC[C@@H]1c1c([nH]c3ccccc13)C2 |
| InChI | InChI=1S/C17H19NO2/c1-2-20-17(19)15-10-7-8-12(15)16-11-5-3-4-6-13(11)18-14(16)9-10/h3-6,10,12,15,18H,2,7-9H2,1H3/t10-,12-,15+/m0/s1 |
| InChIKey | URAJRKWEYCGRQA-ITDIGPHOSA-N |
| XLogP | 3.40 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|