C15H15NO4 — CID 23245119
ethyl 2-(3-oxo-1,4-dihydrofuro[3,4-b]indol-1-yl)propanoate (PubChem CID 23245119) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is ethyl 2-(3-oxo-1,4-dihydrofuro[3,4-b]indol-1-yl)propanoate.
| Compound Name | ethyl 2-(3-oxo-1,4-dihydrofuro[3,4-b]indol-1-yl)propanoate |
|---|---|
| PubChem CID | 23245119 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethyl 2-(3-oxo-1,4-dihydrofuro[3,4-b]indol-1-yl)propanoate |
| SMILES | CCOC(=O)C(C)C1OC(=O)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C15H15NO4/c1-3-19-14(17)8(2)13-11-9-6-4-5-7-10(9)16-12(11)15(18)20-13/h4-8,13,16H,3H2,1-2H3 |
| InChIKey | ZEIMZMZNLIPPPN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|