C14H17N3O4 — CID 153402560
ethyl 3-amino-2-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 153402560) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl 3-amino-2-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | ethyl 3-amino-2-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 153402560 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl 3-amino-2-[(3-hydroxy-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C(CN)NC(=O)c1[nH]c2ccccc2c1O |
| InChI | InChI=1S/C14H17N3O4/c1-2-21-14(20)10(7-15)17-13(19)11-12(18)8-5-3-4-6-9(8)16-11/h3-6,10,16,18H,2,7,15H2,1H3,(H,17,19) |
| InChIKey | QKNPDQWHZXBWQA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |