C16H17F3N2O3 — CID 165167492
ethyl (2S)-2-acetamido-3-[2-(trifluoromethyl)-1H-indol-3-yl]propanoate (PubChem CID 165167492) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is ethyl (2S)-2-acetamido-3-[2-(trifluoromethyl)-1H-indol-3-yl]propanoate.
| Compound Name | ethyl (2S)-2-acetamido-3-[2-(trifluoromethyl)-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 165167492 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | ethyl (2S)-2-acetamido-3-[2-(trifluoromethyl)-1H-indol-3-yl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1c(C(F)(F)F)[nH]c2ccccc12)NC(C)=O |
| InChI | InChI=1S/C16H17F3N2O3/c1-3-24-15(23)13(20-9(2)22)8-11-10-6-4-5-7-12(10)21-14(11)16(17,18)19/h4-7,13,21H,3,8H2,1-2H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | PUIGSETUSDTGEY-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |