C31H38N6O5 — CID 10745703
methyl (2S)-2-acetamido-3-[2-[3-[(2R)-2-acetamido-2-(butylcarbamoylamino)ethyl]-1H-indol-2-yl]-1H-indol-3-yl]propanoate (PubChem CID 10745703) has the molecular formula C31H38N6O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-[2-[3-[(2R)-2-acetamido-2-(butylcarbamoylamino)ethyl]-1H-indol-2-yl]-1H-indol-3-yl]propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-[2-[3-[(2R)-2-acetamido-2-(butylcarbamoylamino)ethyl]-1H-indol-2-yl]-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 10745703 |
| Molecular Formula | C31H38N6O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | methyl (2S)-2-acetamido-3-[2-[3-[(2R)-2-acetamido-2-(butylcarbamoylamino)ethyl]-1H-indol-2-yl]-1H-indol-3-yl]propanoate |
| SMILES | CCCCNC(=O)N[C@H](Cc1c(-c2[nH]c3ccccc3c2C[C@H](NC(C)=O)C(=O)OC)[nH]c2ccccc12)NC(C)=O |
| InChI | InChI=1S/C31H38N6O5/c1-5-6-15-32-31(41)37-27(34-19(3)39)17-23-21-12-8-10-14-25(21)36-29(23)28-22(20-11-7-9-13-24(20)35-28)16-26(30(40)42-4)33-18(2)38/h7-14,26-27,35-36H,5-6,15-17H2,1-4H3,(H,33,38)(H,34,39)(H2,32,37,41)/t26-,27+/m0/s1 |
| InChIKey | XYIKRTHXQRROLH-RRPNLBNLSA-N |
| XLogP | 3.64 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|