C20H18BrNO3 — CID 46237898
methyl 2-acetamido-3-(10-bromoanthracen-9-yl)propanoate (PubChem CID 46237898) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is methyl 2-acetamido-3-(10-bromoanthracen-9-yl)propanoate.
| Compound Name | methyl 2-acetamido-3-(10-bromoanthracen-9-yl)propanoate |
|---|---|
| PubChem CID | 46237898 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | methyl 2-acetamido-3-(10-bromoanthracen-9-yl)propanoate |
| SMILES | COC(=O)C(Cc1c2ccccc2c(Br)c2ccccc12)NC(C)=O |
| InChI | InChI=1S/C20H18BrNO3/c1-12(23)22-18(20(24)25-2)11-17-13-7-3-5-9-15(13)19(21)16-10-6-4-8-14(16)17/h3-10,18H,11H2,1-2H3,(H,22,23) |
| InChIKey | ODBRWYHVLLITAP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|