C14H14F3NO2 — CID 101463365
methyl 4-[2-(trifluoromethyl)-1H-indol-3-yl]butanoate (PubChem CID 101463365) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is methyl 4-[2-(trifluoromethyl)-1H-indol-3-yl]butanoate.
| Compound Name | methyl 4-[2-(trifluoromethyl)-1H-indol-3-yl]butanoate |
|---|---|
| PubChem CID | 101463365 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 4-[2-(trifluoromethyl)-1H-indol-3-yl]butanoate |
| SMILES | COC(=O)CCCc1c(C(F)(F)F)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H14F3NO2/c1-20-12(19)8-4-6-10-9-5-2-3-7-11(9)18-13(10)14(15,16)17/h2-3,5,7,18H,4,6,8H2,1H3 |
| InChIKey | IRARYBXCCWSYSW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |