C15H17NO4 — CID 68579658
methyl 3-(4-methoxy-4-oxobutyl)-1H-indole-2-carboxylate (PubChem CID 68579658) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is methyl 3-(4-methoxy-4-oxobutyl)-1H-indole-2-carboxylate.
| Compound Name | methyl 3-(4-methoxy-4-oxobutyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 68579658 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | methyl 3-(4-methoxy-4-oxobutyl)-1H-indole-2-carboxylate |
| SMILES | COC(=O)CCCc1c(C(=O)OC)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17NO4/c1-19-13(17)9-5-7-11-10-6-3-4-8-12(10)16-14(11)15(18)20-2/h3-4,6,8,16H,5,7,9H2,1-2H3 |
| InChIKey | MEVCSCCSPWLWBF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|