C14H17NO2 — CID 10609557
methyl 4-(2-methyl-1H-indol-3-yl)butanoate (PubChem CID 10609557) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is methyl 4-(2-methyl-1H-indol-3-yl)butanoate.
| Compound Name | methyl 4-(2-methyl-1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 10609557 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl 4-(2-methyl-1H-indol-3-yl)butanoate |
| SMILES | COC(=O)CCCc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H17NO2/c1-10-11(7-5-9-14(16)17-2)12-6-3-4-8-13(12)15-10/h3-4,6,8,15H,5,7,9H2,1-2H3 |
| InChIKey | FBUHCXWLMXOUHN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|