C14H19N3O — CID 116846510
N'-methyl-4-(2-methyl-1H-indol-3-yl)butanehydrazide (PubChem CID 116846510) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N'-methyl-4-(2-methyl-1H-indol-3-yl)butanehydrazide.
| Compound Name | N'-methyl-4-(2-methyl-1H-indol-3-yl)butanehydrazide |
|---|---|
| PubChem CID | 116846510 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N'-methyl-4-(2-methyl-1H-indol-3-yl)butanehydrazide |
| SMILES | CNNC(=O)CCCc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H19N3O/c1-10-11(7-5-9-14(18)17-15-2)12-6-3-4-8-13(12)16-10/h3-4,6,8,15-16H,5,7,9H2,1-2H3,(H,17,18) |
| InChIKey | MLGGJQUEQDKSRU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|