C19H28N3O3+ — CID 148932122
[[8-[2-(2-methyl-1H-indol-3-yl)ethylamino]-8-oxooctanoyl]amino]oxidanium (PubChem CID 148932122) has the molecular formula C19H28N3O3+ and a molecular weight of 346.45 g/mol. Its IUPAC name is [[8-[2-(2-methyl-1H-indol-3-yl)ethylamino]-8-oxooctanoyl]amino]oxidanium.
| Compound Name | [[8-[2-(2-methyl-1H-indol-3-yl)ethylamino]-8-oxooctanoyl]amino]oxidanium |
|---|---|
| PubChem CID | 148932122 |
| Molecular Formula | C19H28N3O3+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [[8-[2-(2-methyl-1H-indol-3-yl)ethylamino]-8-oxooctanoyl]amino]oxidanium |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)CCCCCCC(=O)N[OH2+] |
| InChI | InChI=1S/C19H27N3O3/c1-14-15(16-8-6-7-9-17(16)21-14)12-13-20-18(23)10-4-2-3-5-11-19(24)22-25/h6-9,21,25H,2-5,10-13H2,1H3,(H,20,23)(H,22,24)/p+1 |
| InChIKey | PMDMZAWCQDPSQQ-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|