C20H29N3O2 — CID 167105628
N'-[3-(2-methyl-1H-indol-3-yl)propyl]octanediamide (PubChem CID 167105628) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N'-[3-(2-methyl-1H-indol-3-yl)propyl]octanediamide.
| Compound Name | N'-[3-(2-methyl-1H-indol-3-yl)propyl]octanediamide |
|---|---|
| PubChem CID | 167105628 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N'-[3-(2-methyl-1H-indol-3-yl)propyl]octanediamide |
| SMILES | Cc1[nH]c2ccccc2c1CCCNC(=O)CCCCCCC(N)=O |
| InChI | InChI=1S/C20H29N3O2/c1-15-16(17-9-6-7-11-18(17)23-15)10-8-14-22-20(25)13-5-3-2-4-12-19(21)24/h6-7,9,11,23H,2-5,8,10,12-14H2,1H3,(H2,21,24)(H,22,25) |
| InChIKey | LGEFTRSGQNEMHR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|