C15H14F3NO4 — CID 141482018
methyl 3-(3,3,3-trifluoro-2-methoxycarbonylpropyl)-1H-indole-2-carboxylate (PubChem CID 141482018) has the molecular formula C15H14F3NO4 and a molecular weight of 329.27 g/mol. Its IUPAC name is methyl 3-(3,3,3-trifluoro-2-methoxycarbonylpropyl)-1H-indole-2-carboxylate.
| Compound Name | methyl 3-(3,3,3-trifluoro-2-methoxycarbonylpropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 141482018 |
| Molecular Formula | C15H14F3NO4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | methyl 3-(3,3,3-trifluoro-2-methoxycarbonylpropyl)-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccccc2c1CC(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO4/c1-22-13(20)10(15(16,17)18)7-9-8-5-3-4-6-11(8)19-12(9)14(21)23-2/h3-6,10,19H,7H2,1-2H3 |
| InChIKey | DGUSKVROSDNLCO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|