C14H13NO5 — CID 141481995
methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate (PubChem CID 141481995) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate.
| Compound Name | methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 141481995 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate |
| SMILES | COC(=O)C(=O)Cc1c(C(=O)OC)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H13NO5/c1-19-13(17)11(16)7-9-8-5-3-4-6-10(8)15-12(9)14(18)20-2/h3-6,15H,7H2,1-2H3 |
| InChIKey | UVRWKGVGFDXLOE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|