methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate

C14H13NO5 — CID 141481995

IUPACmethyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate
SMILESCOC(=O)C(=O)Cc1c(C(=O)OC)[nH]c2ccccc12
InChIInChI=1S/C14H13NO5/c1-19-13(17)11(16)7-9-8-5-3-4-6-10(8)15-12(9)14(18)20-2/h3-6,15H,7H2,1-2H3
InChIKeyUVRWKGVGFDXLOE-UHFFFAOYSA-N
MW275.26 g/mol
LogP1.24
Rot. Bonds4

About methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate

methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate (PubChem CID 141481995) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate
PubChem CID141481995
Molecular FormulaC14H13NO5
Molecular Weight275.26 g/mol
Exact Mass275.08
IUPAC Namemethyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate
SMILESCOC(=O)C(=O)Cc1c(C(=O)OC)[nH]c2ccccc12
InChIInChI=1S/C14H13NO5/c1-19-13(17)11(16)7-9-8-5-3-4-6-10(8)15-12(9)14(18)20-2/h3-6,15H,7H2,1-2H3
InChIKeyUVRWKGVGFDXLOE-UHFFFAOYSA-N
XLogP1.24
TPSA85.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.26
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate?
The IUPAC name of methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate (CID 141481995) is methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate?
The canonical SMILES for methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate is COC(=O)C(=O)Cc1c(C(=O)OC)[nH]c2ccccc12.
What is the InChIKey of methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate?
The InChIKey is UVRWKGVGFDXLOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO5/c1-19-13(17)11(16)7-9-8-5-3-4-6-10(8)15-12(9)14(18)20-2/h3-6,15H,7H2,1-2H3.
What are the key properties of methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate?
methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate has a molecular weight of 275.26 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-methoxy-2,3-dioxopropyl)-1H-indole-2-carboxylate is sourced from PubChem (CID 141481995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).