C14H13F5N2O — CID 132555412
N-[2-[2-(1,1,2,2,2-pentafluoroethyl)-1H-indol-3-yl]ethyl]acetamide (PubChem CID 132555412) has the molecular formula C14H13F5N2O and a molecular weight of 320.26 g/mol. Its IUPAC name is N-[2-[2-(1,1,2,2,2-pentafluoroethyl)-1H-indol-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[2-(1,1,2,2,2-pentafluoroethyl)-1H-indol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 132555412 |
| Molecular Formula | C14H13F5N2O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[2-[2-(1,1,2,2,2-pentafluoroethyl)-1H-indol-3-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1c(C(F)(F)C(F)(F)F)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H13F5N2O/c1-8(22)20-7-6-10-9-4-2-3-5-11(9)21-12(10)13(15,16)14(17,18)19/h2-5,21H,6-7H2,1H3,(H,20,22) |
| InChIKey | RTEMKLKABFZISG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|