C31H34N4O2 — CID 67779850
N-[2-(2-benzyl-1H-indol-3-yl)ethyl]acetamide;N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 67779850) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[2-(2-benzyl-1H-indol-3-yl)ethyl]acetamide;N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | N-[2-(2-benzyl-1H-indol-3-yl)ethyl]acetamide;N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 67779850 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | N-[2-(2-benzyl-1H-indol-3-yl)ethyl]acetamide;N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12.CC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H20N2O.C12H14N2O/c1-14(22)20-12-11-17-16-9-5-6-10-18(16)21-19(17)13-15-7-3-2-4-8-15;1-9(15)13-7-6-10-8-14-12-5-3-2-4-11(10)12/h2-10,21H,11-13H2,1H3,(H,20,22);2-5,8,14H,6-7H2,1H3,(H,13,15) |
| InChIKey | FQSDMYJSSQCXTB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|