C23H28N2O — CID 57340104
N-[2-(2-benzyl-1H-indol-3-yl)ethyl]hexanamide (PubChem CID 57340104) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-(2-benzyl-1H-indol-3-yl)ethyl]hexanamide.
| Compound Name | N-[2-(2-benzyl-1H-indol-3-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 57340104 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[2-(2-benzyl-1H-indol-3-yl)ethyl]hexanamide |
| SMILES | CCCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H28N2O/c1-2-3-5-14-23(26)24-16-15-20-19-12-8-9-13-21(19)25-22(20)17-18-10-6-4-7-11-18/h4,6-13,25H,2-3,5,14-17H2,1H3,(H,24,26) |
| InChIKey | QZEICWUXNUBJBN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|