C15H13NO4 — CID 3839231
ethyl 2-oxo-2-(3-oxo-2,4-dihydro-1H-cyclopenta[b]indol-2-yl)acetate (PubChem CID 3839231) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is ethyl 2-oxo-2-(3-oxo-2,4-dihydro-1H-cyclopenta[b]indol-2-yl)acetate.
| Compound Name | ethyl 2-oxo-2-(3-oxo-2,4-dihydro-1H-cyclopenta[b]indol-2-yl)acetate |
|---|---|
| PubChem CID | 3839231 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | ethyl 2-oxo-2-(3-oxo-2,4-dihydro-1H-cyclopenta[b]indol-2-yl)acetate |
| SMILES | CCOC(=O)C(=O)C1Cc2c([nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C15H13NO4/c1-2-20-15(19)14(18)10-7-9-8-5-3-4-6-11(8)16-12(9)13(10)17/h3-6,10,16H,2,7H2,1H3 |
| InChIKey | GSYKINWVLHVYLT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|