C19H21NO5 — CID 156612660
ethyl 2-(2-ethoxy-2-oxoethyl)-1-oxo-2,3,4,9-tetrahydrocarbazole-3-carboxylate (PubChem CID 156612660) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-2-oxoethyl)-1-oxo-2,3,4,9-tetrahydrocarbazole-3-carboxylate.
| Compound Name | ethyl 2-(2-ethoxy-2-oxoethyl)-1-oxo-2,3,4,9-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 156612660 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethyl 2-(2-ethoxy-2-oxoethyl)-1-oxo-2,3,4,9-tetrahydrocarbazole-3-carboxylate |
| SMILES | CCOC(=O)CC1C(=O)c2[nH]c3ccccc3c2CC1C(=O)OCC |
| InChI | InChI=1S/C19H21NO5/c1-3-24-16(21)10-13-14(19(23)25-4-2)9-12-11-7-5-6-8-15(11)20-17(12)18(13)22/h5-8,13-14,20H,3-4,9-10H2,1-2H3 |
| InChIKey | VKMYTHBQFSVKCU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|